C24H34FN3O — CID 142004244
2-(4-fluorophenyl)-N-methylacetamide;N'-methyl-N'-pent-4-enyl-1-phenylpropane-1,3-diamine (PubChem CID 142004244) has the molecular formula C24H34FN3O and a molecular weight of 399.55 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-methylacetamide;N'-methyl-N'-pent-4-enyl-1-phenylpropane-1,3-diamine.
| Compound Name | 2-(4-fluorophenyl)-N-methylacetamide;N'-methyl-N'-pent-4-enyl-1-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 142004244 |
| Molecular Formula | C24H34FN3O |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 2-(4-fluorophenyl)-N-methylacetamide;N'-methyl-N'-pent-4-enyl-1-phenylpropane-1,3-diamine |
| SMILES | C=CCCCN(C)CCC(N)c1ccccc1.CNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H24N2.C9H10FNO/c1-3-4-8-12-17(2)13-11-15(16)14-9-6-5-7-10-14;1-11-9(12)6-7-2-4-8(10)5-3-7/h3,5-7,9-10,15H,1,4,8,11-13,16H2,2H3;2-5H,6H2,1H3,(H,11,12) |
| InChIKey | VOAZACKHSPNXCB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|