C19H26 — CID 142004323
1-[(3E)-3,6-dimethylhepta-3,5-dienyl]-3-ethenyl-2,4-dimethylbenzene (PubChem CID 142004323) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-[(3E)-3,6-dimethylhepta-3,5-dienyl]-3-ethenyl-2,4-dimethylbenzene.
| Compound Name | 1-[(3E)-3,6-dimethylhepta-3,5-dienyl]-3-ethenyl-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 142004323 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-[(3E)-3,6-dimethylhepta-3,5-dienyl]-3-ethenyl-2,4-dimethylbenzene |
| SMILES | C=Cc1c(C)ccc(CC/C(C)=C/C=C(C)C)c1C |
| InChI | InChI=1S/C19H26/c1-7-19-16(5)11-13-18(17(19)6)12-10-15(4)9-8-14(2)3/h7-9,11,13H,1,10,12H2,2-6H3/b15-9+ |
| InChIKey | VBTVVBINFPZFDX-OQLLNIDSSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|