C18H33NO — CID 142004617
cyclohexanol;4-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-amine (PubChem CID 142004617) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is cyclohexanol;4-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-amine.
| Compound Name | cyclohexanol;4-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 142004617 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | cyclohexanol;4-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-amine |
| SMILES | C=CC1CCC(N)C2CCCCC12.OC1CCCCC1 |
| InChI | InChI=1S/C12H21N.C6H12O/c1-2-9-7-8-12(13)11-6-4-3-5-10(9)11;7-6-4-2-1-3-5-6/h2,9-12H,1,3-8,13H2;6-7H,1-5H2 |
| InChIKey | QNHCPTBTQUORSL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|