About CID 142005482
CID 142005482 (PubChem CID 142005482) has the molecular formula C4H4BNO
and a molecular weight of 92.89 g/mol.
Molecular Properties
| Compound Name | CID 142005482 |
| PubChem CID | 142005482 |
| Molecular Formula | C4H4BNO |
| Molecular Weight | 92.89 g/mol |
| Exact Mass | 93.04 |
| IUPAC Name | — |
| SMILES | [B]c1ocnc1C |
| InChI | InChI=1S/C4H4BNO/c1-3-4(5)7-2-6-3/h2H,1H3 |
| InChIKey | KBXJKKXOXJOYJT-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.89 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 142005482 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142005482?
The IUPAC name of CID 142005482 (CID 142005482) is not available.
What is the SMILES notation for CID 142005482?
The canonical SMILES for CID 142005482 is [B]c1ocnc1C.
What is the InChIKey of CID 142005482?
The InChIKey is KBXJKKXOXJOYJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BNO/c1-3-4(5)7-2-6-3/h2H,1H3.
What are the key properties of CID 142005482?
CID 142005482 has a molecular weight of 92.89 g/mol, XLogP of -0.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142005482 is sourced from PubChem (CID 142005482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).