C10H4F3N3O — CID 142005555
N-(2,5-dicyanophenyl)-2,2,2-trifluoroacetamide (PubChem CID 142005555) has the molecular formula C10H4F3N3O and a molecular weight of 239.16 g/mol. Its IUPAC name is N-(2,5-dicyanophenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2,5-dicyanophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 142005555 |
| Molecular Formula | C10H4F3N3O |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | N-(2,5-dicyanophenyl)-2,2,2-trifluoroacetamide |
| SMILES | N#Cc1ccc(C#N)c(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H4F3N3O/c11-10(12,13)9(17)16-8-3-6(4-14)1-2-7(8)5-15/h1-3H,(H,16,17) |
| InChIKey | GHXPTTIVJVWYFK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |