About (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide
(2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide (PubChem CID 142005588) has the molecular formula C13H23IN2O2
and a molecular weight of 366.24 g/mol. Its IUPAC name is (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide.
Molecular Properties
| Compound Name | (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide |
| PubChem CID | 142005588 |
| Molecular Formula | C13H23IN2O2 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide |
| SMILES | C/C=C/C[C@H](C(N)=O)C(CC(C)(C)C)C(=O)NI |
| InChI | InChI=1S/C13H23IN2O2/c1-5-6-7-9(11(15)17)10(12(18)16-14)8-13(2,3)4/h5-6,9-10H,7-8H2,1-4H3,(H2,15,17)(H,16,18)/b6-5+/t9-,10?/m0/s1 |
| InChIKey | ZGCUVCYNROIYFM-JFJMBRGZSA-N |
| XLogP | 2.57 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide?
The IUPAC name of (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide (CID 142005588) is (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide.
What is the SMILES notation for (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide?
The canonical SMILES for (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide is C/C=C/C[C@H](C(N)=O)C(CC(C)(C)C)C(=O)NI.
What is the InChIKey of (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide?
The InChIKey is ZGCUVCYNROIYFM-JFJMBRGZSA-N. The full InChI is InChI=1S/C13H23IN2O2/c1-5-6-7-9(11(15)17)10(12(18)16-14)8-13(2,3)4/h5-6,9-10H,7-8H2,1-4H3,(H2,15,17)(H,16,18)/b6-5+/t9-,10?/m0/s1.
What are the key properties of (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide?
(2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide has a molecular weight of 366.24 g/mol, XLogP of 2.57, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(E)-but-2-enyl]-3-(2,2-dimethylpropyl)-N'-iodobutanediamide is sourced from PubChem (CID 142005588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).