C26H32N2O4 — CID 142005648
5-methyl-3-[(5-methyl-6-oxo-7H-benzo[d][1]benzazepin-7-yl)carbamoyl]hexanoic acid;prop-1-ene (PubChem CID 142005648) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 5-methyl-3-[(5-methyl-6-oxo-7H-benzo[d][1]benzazepin-7-yl)carbamoyl]hexanoic acid;prop-1-ene.
| Compound Name | 5-methyl-3-[(5-methyl-6-oxo-7H-benzo[d][1]benzazepin-7-yl)carbamoyl]hexanoic acid;prop-1-ene |
|---|---|
| PubChem CID | 142005648 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 5-methyl-3-[(5-methyl-6-oxo-7H-benzo[d][1]benzazepin-7-yl)carbamoyl]hexanoic acid;prop-1-ene |
| SMILES | C=CC.CC(C)CC(CC(=O)O)C(=O)NC1C(=O)N(C)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H26N2O4.C3H6/c1-14(2)12-15(13-20(26)27)22(28)24-21-18-10-5-4-8-16(18)17-9-6-7-11-19(17)25(3)23(21)29;1-3-2/h4-11,14-15,21H,12-13H2,1-3H3,(H,24,28)(H,26,27);3H,1H2,2H3 |
| InChIKey | XHFODUSGTOYBDE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|