About 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene
1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene (PubChem CID 142005744) has the molecular formula C16H22BrN3S2
and a molecular weight of 400.41 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene.
Molecular Properties
| Compound Name | 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene |
| PubChem CID | 142005744 |
| Molecular Formula | C16H22BrN3S2 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene |
| SMILES | C=C(S)/C=C(\C)CCNC(=S)Nc1ccc(Br)cn1.C=CC |
| InChI | InChI=1S/C13H16BrN3S2.C3H6/c1-9(7-10(2)18)5-6-15-13(19)17-12-4-3-11(14)8-16-12;1-3-2/h3-4,7-8,18H,2,5-6H2,1H3,(H2,15,16,17,19);3H,1H2,2H3/b9-7+; |
| InChIKey | IMXLDUGAANUQGB-BXTVWIJMSA-N |
| XLogP | 5.10 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene?
The IUPAC name of 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene (CID 142005744) is 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene.
What is the SMILES notation for 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene?
The canonical SMILES for 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene is C=C(S)/C=C(\C)CCNC(=S)Nc1ccc(Br)cn1.C=CC.
What is the InChIKey of 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene?
The InChIKey is IMXLDUGAANUQGB-BXTVWIJMSA-N. The full InChI is InChI=1S/C13H16BrN3S2.C3H6/c1-9(7-10(2)18)5-6-15-13(19)17-12-4-3-11(14)8-16-12;1-3-2/h3-4,7-8,18H,2,5-6H2,1H3,(H2,15,16,17,19);3H,1H2,2H3/b9-7+;.
What are the key properties of 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene?
1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene has a molecular weight of 400.41 g/mol, XLogP of 5.10, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-2-pyridinyl)-3-[(3E)-3-methyl-5-sulfanylhexa-3,5-dienyl]thiourea;prop-1-ene is sourced from PubChem (CID 142005744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).