C17H34OS — CID 142005760
ethane;(E)-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylbut-2-en-1-ol (PubChem CID 142005760) has the molecular formula C17H34OS and a molecular weight of 286.52 g/mol. Its IUPAC name is ethane;(E)-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylbut-2-en-1-ol.
| Compound Name | ethane;(E)-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylbut-2-en-1-ol |
|---|---|
| PubChem CID | 142005760 |
| Molecular Formula | C17H34OS |
| Molecular Weight | 286.52 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | ethane;(E)-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylbut-2-en-1-ol |
| SMILES | C=C/C=C(\C=C/C)S/C(=C/C)CO.CC.CC.CC |
| InChI | InChI=1S/C11H16OS.3C2H6/c1-4-7-11(8-5-2)13-10(6-3)9-12;3*1-2/h4-8,12H,1,9H2,2-3H3;3*1-2H3/b8-5-,10-6+,11-7+;;; |
| InChIKey | OWURRAKZCFWOMV-UOGZYNQFSA-N |
| XLogP | 6.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.52 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|