About (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol
(4-chlorocyclohexa-1,3-dien-1-yl)methanethiol (PubChem CID 142005793) has the molecular formula C7H9ClS
and a molecular weight of 160.67 g/mol. Its IUPAC name is (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol.
Molecular Properties
| Compound Name | (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol |
| PubChem CID | 142005793 |
| Molecular Formula | C7H9ClS |
| Molecular Weight | 160.67 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol |
| SMILES | SCC1=CC=C(Cl)CC1 |
| InChI | InChI=1S/C7H9ClS/c8-7-3-1-6(5-9)2-4-7/h1,3,9H,2,4-5H2 |
| InChIKey | WJPGWXWEEWEWQJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol?
The IUPAC name of (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol (CID 142005793) is (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol.
What is the SMILES notation for (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol?
The canonical SMILES for (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol is SCC1=CC=C(Cl)CC1.
What is the InChIKey of (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol?
The InChIKey is WJPGWXWEEWEWQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClS/c8-7-3-1-6(5-9)2-4-7/h1,3,9H,2,4-5H2.
What are the key properties of (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol?
(4-chlorocyclohexa-1,3-dien-1-yl)methanethiol has a molecular weight of 160.67 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorocyclohexa-1,3-dien-1-yl)methanethiol is sourced from PubChem (CID 142005793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).