About 2,6-dimethyl-4H-1,3-oxazine
2,6-dimethyl-4H-1,3-oxazine (PubChem CID 142005861) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is 2,6-dimethyl-4H-1,3-oxazine.
Molecular Properties
| Compound Name | 2,6-dimethyl-4H-1,3-oxazine |
| PubChem CID | 142005861 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 2,6-dimethyl-4H-1,3-oxazine |
| SMILES | CC1=CCN=C(C)O1 |
| InChI | InChI=1S/C6H9NO/c1-5-3-4-7-6(2)8-5/h3H,4H2,1-2H3 |
| InChIKey | GXUJZYFJLCEPFR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethyl-4H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4H-1,3-oxazine?
The IUPAC name of 2,6-dimethyl-4H-1,3-oxazine (CID 142005861) is 2,6-dimethyl-4H-1,3-oxazine.
What is the SMILES notation for 2,6-dimethyl-4H-1,3-oxazine?
The canonical SMILES for 2,6-dimethyl-4H-1,3-oxazine is CC1=CCN=C(C)O1.
What is the InChIKey of 2,6-dimethyl-4H-1,3-oxazine?
The InChIKey is GXUJZYFJLCEPFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO/c1-5-3-4-7-6(2)8-5/h3H,4H2,1-2H3.
What are the key properties of 2,6-dimethyl-4H-1,3-oxazine?
2,6-dimethyl-4H-1,3-oxazine has a molecular weight of 111.14 g/mol, XLogP of 1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4H-1,3-oxazine is sourced from PubChem (CID 142005861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).