About 2-methoxy-N,4-dimethylcyclopentan-1-amine
2-methoxy-N,4-dimethylcyclopentan-1-amine (PubChem CID 142006411) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-methoxy-N,4-dimethylcyclopentan-1-amine.
Molecular Properties
| Compound Name | 2-methoxy-N,4-dimethylcyclopentan-1-amine |
| PubChem CID | 142006411 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-methoxy-N,4-dimethylcyclopentan-1-amine |
| SMILES | CNC1CC(C)CC1OC |
| InChI | InChI=1S/C8H17NO/c1-6-4-7(9-2)8(5-6)10-3/h6-9H,4-5H2,1-3H3 |
| InChIKey | VIACGNLOUPQLGW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-N,4-dimethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N,4-dimethylcyclopentan-1-amine?
The IUPAC name of 2-methoxy-N,4-dimethylcyclopentan-1-amine (CID 142006411) is 2-methoxy-N,4-dimethylcyclopentan-1-amine.
What is the SMILES notation for 2-methoxy-N,4-dimethylcyclopentan-1-amine?
The canonical SMILES for 2-methoxy-N,4-dimethylcyclopentan-1-amine is CNC1CC(C)CC1OC.
What is the InChIKey of 2-methoxy-N,4-dimethylcyclopentan-1-amine?
The InChIKey is VIACGNLOUPQLGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-6-4-7(9-2)8(5-6)10-3/h6-9H,4-5H2,1-3H3.
What are the key properties of 2-methoxy-N,4-dimethylcyclopentan-1-amine?
2-methoxy-N,4-dimethylcyclopentan-1-amine has a molecular weight of 143.23 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N,4-dimethylcyclopentan-1-amine is sourced from PubChem (CID 142006411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).