About (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid
(3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid (PubChem CID 142006504) has the molecular formula C22H39NO4
and a molecular weight of 381.56 g/mol. Its IUPAC name is (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid.
Molecular Properties
| Compound Name | (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid |
| PubChem CID | 142006504 |
| Molecular Formula | C22H39NO4 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid |
| SMILES | C=C/C=C(\C=C)C(CC)CC.O=C(O)CCCCCCCNC(=O)CCO |
| InChI | InChI=1S/C11H21NO4.C11H18/c13-9-7-10(14)12-8-5-3-1-2-4-6-11(15)16;1-5-9-11(8-4)10(6-2)7-3/h13H,1-9H2,(H,12,14)(H,15,16);5,8-10H,1,4,6-7H2,2-3H3/b;11-9+ |
| InChIKey | BAUJDSVORIAYNZ-LBOMLTECSA-N |
| XLogP | 4.63 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid?
The IUPAC name of (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid (CID 142006504) is (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid.
What is the SMILES notation for (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid?
The canonical SMILES for (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid is C=C/C=C(\C=C)C(CC)CC.O=C(O)CCCCCCCNC(=O)CCO.
What is the InChIKey of (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid?
The InChIKey is BAUJDSVORIAYNZ-LBOMLTECSA-N. The full InChI is InChI=1S/C11H21NO4.C11H18/c13-9-7-10(14)12-8-5-3-1-2-4-6-11(15)16;1-5-9-11(8-4)10(6-2)7-3/h13H,1-9H2,(H,12,14)(H,15,16);5,8-10H,1,4,6-7H2,2-3H3/b;11-9+.
What are the key properties of (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid?
(3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid has a molecular weight of 381.56 g/mol, XLogP of 4.63, 15 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-ethenyl-5-ethylhepta-1,3-diene;8-(3-hydroxypropanoylamino)octanoic acid is sourced from PubChem (CID 142006504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).