C16H20N2O — CID 142006790
(E)-N-(3,4-dihydropyridin-5-ylmethyl)-3-(4-methylcyclohexa-2,4-dien-1-yl)prop-2-enamide (PubChem CID 142006790) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (E)-N-(3,4-dihydropyridin-5-ylmethyl)-3-(4-methylcyclohexa-2,4-dien-1-yl)prop-2-enamide.
| Compound Name | (E)-N-(3,4-dihydropyridin-5-ylmethyl)-3-(4-methylcyclohexa-2,4-dien-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 142006790 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (E)-N-(3,4-dihydropyridin-5-ylmethyl)-3-(4-methylcyclohexa-2,4-dien-1-yl)prop-2-enamide |
| SMILES | CC1=CCC(/C=C/C(=O)NCC2=CN=CCC2)C=C1 |
| InChI | InChI=1S/C16H20N2O/c1-13-4-6-14(7-5-13)8-9-16(19)18-12-15-3-2-10-17-11-15/h4-6,8-11,14H,2-3,7,12H2,1H3,(H,18,19)/b9-8+ |
| InChIKey | ADCIVRCJGUOWAL-CMDGGOBGSA-N |
| XLogP | 2.93 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|