C26H36N2O3S — CID 142006850
(4R,5R)-3,3-dibutyl-7-(dimethylamino)-5-(3-nitrophenyl)-4,5-dihydro-2H-1-benzothiepin-4-ol (PubChem CID 142006850) has the molecular formula C26H36N2O3S and a molecular weight of 456.65 g/mol. Its IUPAC name is (4R,5R)-3,3-dibutyl-7-(dimethylamino)-5-(3-nitrophenyl)-4,5-dihydro-2H-1-benzothiepin-4-ol.
| Compound Name | (4R,5R)-3,3-dibutyl-7-(dimethylamino)-5-(3-nitrophenyl)-4,5-dihydro-2H-1-benzothiepin-4-ol |
|---|---|
| PubChem CID | 142006850 |
| Molecular Formula | C26H36N2O3S |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (4R,5R)-3,3-dibutyl-7-(dimethylamino)-5-(3-nitrophenyl)-4,5-dihydro-2H-1-benzothiepin-4-ol |
| SMILES | CCCCC1(CCCC)CSc2ccc(N(C)C)cc2[C@@H](c2cccc([N+](=O)[O-])c2)[C@H]1O |
| InChI | InChI=1S/C26H36N2O3S/c1-5-7-14-26(15-8-6-2)18-32-23-13-12-20(27(3)4)17-22(23)24(25(26)29)19-10-9-11-21(16-19)28(30)31/h9-13,16-17,24-25,29H,5-8,14-15,18H2,1-4H3/t24-,25-/m1/s1 |
| InChIKey | SPRSJLYUUKVURS-JWQCQUIFSA-N |
| XLogP | 6.63 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|