C21H27N3O2S — CID 142007049
4-butan-2-yl-3-butyl-N-(4-nitronaphthalen-1-yl)-1,3-thiazolidin-2-imine (PubChem CID 142007049) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is 4-butan-2-yl-3-butyl-N-(4-nitronaphthalen-1-yl)-1,3-thiazolidin-2-imine.
| Compound Name | 4-butan-2-yl-3-butyl-N-(4-nitronaphthalen-1-yl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 142007049 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-butan-2-yl-3-butyl-N-(4-nitronaphthalen-1-yl)-1,3-thiazolidin-2-imine |
| SMILES | CCCCN1/C(=N/c2ccc([N+](=O)[O-])c3ccccc23)SCC1C(C)CC |
| InChI | InChI=1S/C21H27N3O2S/c1-4-6-13-23-20(15(3)5-2)14-27-21(23)22-18-11-12-19(24(25)26)17-10-8-7-9-16(17)18/h7-12,15,20H,4-6,13-14H2,1-3H3/b22-21- |
| InChIKey | WSLWVGVYFVXIGA-DQRAZIAOSA-N |
| XLogP | 6.00 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|