C17H13ClN2S — CID 142007218
2-(4-chlorophenyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-9-thione (PubChem CID 142007218) has the molecular formula C17H13ClN2S and a molecular weight of 312.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-9-thione.
| Compound Name | 2-(4-chlorophenyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-9-thione |
|---|---|
| PubChem CID | 142007218 |
| Molecular Formula | C17H13ClN2S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-(4-chlorophenyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-9-thione |
| SMILES | S=C1NCCc2c(-c3ccc(Cl)cc3)[nH]c3cccc1c23 |
| InChI | InChI=1S/C17H13ClN2S/c18-11-6-4-10(5-7-11)16-12-8-9-19-17(21)13-2-1-3-14(20-16)15(12)13/h1-7,20H,8-9H2,(H,19,21) |
| InChIKey | GLUKNPOBXRKWMY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|