C19H28O4 — CID 142008647
(4R,6R)-6-[3-[(1S,2S,6S,8aR)-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]propyl]-4-hydroxyoxan-2-one (PubChem CID 142008647) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (4R,6R)-6-[3-[(1S,2S,6S,8aR)-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]propyl]-4-hydroxyoxan-2-one.
| Compound Name | (4R,6R)-6-[3-[(1S,2S,6S,8aR)-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]propyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 142008647 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (4R,6R)-6-[3-[(1S,2S,6S,8aR)-6-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]propyl]-4-hydroxyoxan-2-one |
| SMILES | C[C@H]1C=CC2=C[C@@H](O)CC[C@@H]2[C@H]1CCC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C19H28O4/c1-12-5-6-13-9-14(20)7-8-18(13)17(12)4-2-3-16-10-15(21)11-19(22)23-16/h5-6,9,12,14-18,20-21H,2-4,7-8,10-11H2,1H3/t12-,14-,15+,16+,17-,18-/m0/s1 |
| InChIKey | FMQOJPJEBGMGFM-SDAJNKIFSA-N |
| XLogP | 2.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |