C19H32O3 — CID 142008990
(5R)-4,5,9,11,12-pentamethyl-3-methylidene-oxacyclotetradecane-2,10-dione (PubChem CID 142008990) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (5R)-4,5,9,11,12-pentamethyl-3-methylidene-oxacyclotetradecane-2,10-dione.
| Compound Name | (5R)-4,5,9,11,12-pentamethyl-3-methylidene-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 142008990 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (5R)-4,5,9,11,12-pentamethyl-3-methylidene-oxacyclotetradecane-2,10-dione |
| SMILES | C=C1C(=O)OCCC(C)C(C)C(=O)C(C)CCC[C@@H](C)C1C |
| InChI | InChI=1S/C19H32O3/c1-12-8-7-9-14(3)18(20)16(5)13(2)10-11-22-19(21)17(6)15(12)4/h12-16H,6-11H2,1-5H3/t12-,13?,14?,15?,16?/m1/s1 |
| InChIKey | FMNDMZDKLVAMDV-DYCFOQDWSA-N |
| XLogP | 4.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|