C23H42N2O — CID 142009191
ethane;1-[3-[(3E,5Z)-8-piperidin-1-ylocta-3,5-dien-3-yl]oxypropyl]-3,6-dihydro-2H-pyridine (PubChem CID 142009191) has the molecular formula C23H42N2O and a molecular weight of 362.60 g/mol. Its IUPAC name is ethane;1-[3-[(3E,5Z)-8-piperidin-1-ylocta-3,5-dien-3-yl]oxypropyl]-3,6-dihydro-2H-pyridine.
| Compound Name | ethane;1-[3-[(3E,5Z)-8-piperidin-1-ylocta-3,5-dien-3-yl]oxypropyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 142009191 |
| Molecular Formula | C23H42N2O |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.33 |
| IUPAC Name | ethane;1-[3-[(3E,5Z)-8-piperidin-1-ylocta-3,5-dien-3-yl]oxypropyl]-3,6-dihydro-2H-pyridine |
| SMILES | CC.CC/C(=C\C=C/CCN1CCCCC1)OCCCN1CC=CCC1 |
| InChI | InChI=1S/C21H36N2O.C2H6/c1-2-21(24-20-12-19-23-17-10-5-11-18-23)13-6-3-7-14-22-15-8-4-9-16-22;1-2/h3,5-6,10,13H,2,4,7-9,11-12,14-20H2,1H3;1-2H3/b6-3-,21-13+; |
| InChIKey | RVRVNUICXSFEER-OCBLNHLASA-N |
| XLogP | 5.41 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|