About N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene
N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene (PubChem CID 142009383) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene.
Molecular Properties
| Compound Name | N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene |
| PubChem CID | 142009383 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene |
| SMILES | C=CC.CCN(CCOC)CCC(C)(C)C |
| InChI | InChI=1S/C11H25NO.C3H6/c1-6-12(9-10-13-5)8-7-11(2,3)4;1-3-2/h6-10H2,1-5H3;3H,1H2,2H3 |
| InChIKey | NSRAENQDKYYGDA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene?
The IUPAC name of N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene (CID 142009383) is N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene.
What is the SMILES notation for N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene?
The canonical SMILES for N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene is C=CC.CCN(CCOC)CCC(C)(C)C.
What is the InChIKey of N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene?
The InChIKey is NSRAENQDKYYGDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO.C3H6/c1-6-12(9-10-13-5)8-7-11(2,3)4;1-3-2/h6-10H2,1-5H3;3H,1H2,2H3.
What are the key properties of N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene?
N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene has a molecular weight of 229.41 g/mol, XLogP of 3.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine;prop-1-ene is sourced from PubChem (CID 142009383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).