About 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine
4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine (PubChem CID 142009501) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine.
Molecular Properties
| Compound Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine |
| PubChem CID | 142009501 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine |
| SMILES | C=C/C=C(\C=C)OC1CCNCC1 |
| InChI | InChI=1S/C11H17NO/c1-3-5-10(4-2)13-11-6-8-12-9-7-11/h3-5,11-12H,1-2,6-9H2/b10-5+ |
| InChIKey | XXHNBXGHTUELJA-BJMVGYQFSA-N |
| XLogP | 2.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine?
The IUPAC name of 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine (CID 142009501) is 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine.
What is the SMILES notation for 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine?
The canonical SMILES for 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine is C=C/C=C(\C=C)OC1CCNCC1.
What is the InChIKey of 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine?
The InChIKey is XXHNBXGHTUELJA-BJMVGYQFSA-N. The full InChI is InChI=1S/C11H17NO/c1-3-5-10(4-2)13-11-6-8-12-9-7-11/h3-5,11-12H,1-2,6-9H2/b10-5+.
What are the key properties of 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine?
4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine has a molecular weight of 179.26 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-hexa-1,3,5-trien-3-yl]oxypiperidine is sourced from PubChem (CID 142009501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).