C15H28N2 — CID 142009709
(2Z)-N,3-dimethylpenta-2,4-dien-1-imine;1,4,4-trimethylpiperidine (PubChem CID 142009709) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (2Z)-N,3-dimethylpenta-2,4-dien-1-imine;1,4,4-trimethylpiperidine.
| Compound Name | (2Z)-N,3-dimethylpenta-2,4-dien-1-imine;1,4,4-trimethylpiperidine |
|---|---|
| PubChem CID | 142009709 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (2Z)-N,3-dimethylpenta-2,4-dien-1-imine;1,4,4-trimethylpiperidine |
| SMILES | C=C/C(C)=C\C=N\C.CN1CCC(C)(C)CC1 |
| InChI | InChI=1S/C8H17N.C7H11N/c1-8(2)4-6-9(3)7-5-8;1-4-7(2)5-6-8-3/h4-7H2,1-3H3;4-6H,1H2,2-3H3/b;7-5-,8-6+ |
| InChIKey | FMZHXODLYZOQBD-VFRJUPNGSA-N |
| XLogP | 3.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|