About 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one
2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one (PubChem CID 142009869) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one.
Molecular Properties
| Compound Name | 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one |
| PubChem CID | 142009869 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one |
| SMILES | CCOCC=O.CNCCCCCC(C)=O |
| InChI | InChI=1S/C8H17NO.C4H8O2/c1-8(10)6-4-3-5-7-9-2;1-2-6-4-3-5/h9H,3-7H2,1-2H3;3H,2,4H2,1H3 |
| InChIKey | UYOVLRGGESXZMZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one?
The IUPAC name of 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one (CID 142009869) is 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one.
What is the SMILES notation for 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one?
The canonical SMILES for 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one is CCOCC=O.CNCCCCCC(C)=O.
What is the InChIKey of 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one?
The InChIKey is UYOVLRGGESXZMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C4H8O2/c1-8(10)6-4-3-5-7-9-2;1-2-6-4-3-5/h9H,3-7H2,1-2H3;3H,2,4H2,1H3.
What are the key properties of 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one?
2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one has a molecular weight of 231.34 g/mol, XLogP of 1.58, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyacetaldehyde;7-(methylamino)heptan-2-one is sourced from PubChem (CID 142009869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).