C7H9F3N2 — CID 142010062
N-[(E)-4,4,4-trifluoro-2,3-dimethylbut-2-enylidene]methanimidamide (PubChem CID 142010062) has the molecular formula C7H9F3N2 and a molecular weight of 178.16 g/mol. Its IUPAC name is N-[(E)-4,4,4-trifluoro-2,3-dimethylbut-2-enylidene]methanimidamide.
| Compound Name | N-[(E)-4,4,4-trifluoro-2,3-dimethylbut-2-enylidene]methanimidamide |
|---|---|
| PubChem CID | 142010062 |
| Molecular Formula | C7H9F3N2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | N-[(E)-4,4,4-trifluoro-2,3-dimethylbut-2-enylidene]methanimidamide |
| SMILES | [H]/N=C/N=C/C(C)=C(\C)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2/c1-5(3-12-4-11)6(2)7(8,9)10/h3-4,11H,1-2H3/b6-5+,11-4+,12-3+ |
| InChIKey | UFEUNHWLXHSJNL-HBTQIYPQSA-N |
| XLogP | 2.56 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|