C25H27F2N4O4+ — CID 142010213
[(E)-2-[carboxymethyl-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]carbamoyl]-3-iminobut-1-enyl]-(2,4-difluorophenyl)azanium (PubChem CID 142010213) has the molecular formula C25H27F2N4O4+ and a molecular weight of 485.51 g/mol. Its IUPAC name is [(E)-2-[carboxymethyl-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]carbamoyl]-3-iminobut-1-enyl]-(2,4-difluorophenyl)azanium.
| Compound Name | [(E)-2-[carboxymethyl-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]carbamoyl]-3-iminobut-1-enyl]-(2,4-difluorophenyl)azanium |
|---|---|
| PubChem CID | 142010213 |
| Molecular Formula | C25H27F2N4O4+ |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | [(E)-2-[carboxymethyl-[3-cyano-4-(2,2-dimethylpropoxy)phenyl]carbamoyl]-3-iminobut-1-enyl]-(2,4-difluorophenyl)azanium |
| SMILES | [H]/N=C(C)/C(=C\[NH2+]c1ccc(F)cc1F)C(=O)N(CC(=O)O)c1ccc(OCC(C)(C)C)c(C#N)c1 |
| InChI | InChI=1S/C25H26F2N4O4/c1-15(29)19(12-30-21-7-5-17(26)10-20(21)27)24(34)31(13-23(32)33)18-6-8-22(16(9-18)11-28)35-14-25(2,3)4/h5-10,12,29-30H,13-14H2,1-4H3,(H,32,33)/p+1/b19-12+,29-15+ |
| InChIKey | QCSTVRYZZDCISN-NAYQVHHLSA-O |
| XLogP | 3.50 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|