C8H3F5N4 — CID 142010770
1-cyano-2-(2,3,4,5,6-pentafluorophenyl)guanidine (PubChem CID 142010770) has the molecular formula C8H3F5N4 and a molecular weight of 250.13 g/mol. Its IUPAC name is 1-cyano-2-(2,3,4,5,6-pentafluorophenyl)guanidine.
| Compound Name | 1-cyano-2-(2,3,4,5,6-pentafluorophenyl)guanidine |
|---|---|
| PubChem CID | 142010770 |
| Molecular Formula | C8H3F5N4 |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 1-cyano-2-(2,3,4,5,6-pentafluorophenyl)guanidine |
| SMILES | N#CN/C(N)=N\c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H3F5N4/c9-2-3(10)5(12)7(6(13)4(2)11)17-8(15)16-1-14/h(H3,15,16,17) |
| InChIKey | IENBPQWDYIKMJH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|