About 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane
2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane (PubChem CID 142010928) has the molecular formula C17H21N5OS
and a molecular weight of 343.46 g/mol. Its IUPAC name is 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane.
Molecular Properties
| Compound Name | 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane |
| PubChem CID | 142010928 |
| Molecular Formula | C17H21N5OS |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane |
| SMILES | C=C(N)c1csc(N=C(N)Nc2ccc3oc(C)cc3c2)n1.CC |
| InChI | InChI=1S/C15H15N5OS.C2H6/c1-8-5-10-6-11(3-4-13(10)21-8)18-14(17)20-15-19-12(7-22-15)9(2)16;1-2/h3-7H,2,16H2,1H3,(H3,17,18,19,20);1-2H3 |
| InChIKey | RCHDSSSQDDQLNE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane?
The IUPAC name of 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane (CID 142010928) is 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane.
What is the SMILES notation for 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane?
The canonical SMILES for 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane is C=C(N)c1csc(N=C(N)Nc2ccc3oc(C)cc3c2)n1.CC.
What is the InChIKey of 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane?
The InChIKey is RCHDSSSQDDQLNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5OS.C2H6/c1-8-5-10-6-11(3-4-13(10)21-8)18-14(17)20-15-19-12(7-22-15)9(2)16;1-2/h3-7H,2,16H2,1H3,(H3,17,18,19,20);1-2H3.
What are the key properties of 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane?
2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane has a molecular weight of 343.46 g/mol, XLogP of 4.21, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-aminoethenyl)-1,3-thiazol-2-yl]-1-(2-methyl-1-benzofuran-5-yl)guanidine;ethane is sourced from PubChem (CID 142010928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).