About ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide
ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide (PubChem CID 142011180) has the molecular formula C18H25N3O2
and a molecular weight of 315.42 g/mol. Its IUPAC name is ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide.
Molecular Properties
| Compound Name | ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide |
| PubChem CID | 142011180 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide |
| SMILES | C=C.CCCC(C)C(=O)N/C(N)=N/c1ccc2oc(C)cc2c1 |
| InChI | InChI=1S/C16H21N3O2.C2H4/c1-4-5-10(2)15(20)19-16(17)18-13-6-7-14-12(9-13)8-11(3)21-14;1-2/h6-10H,4-5H2,1-3H3,(H3,17,18,19,20);1-2H2 |
| InChIKey | GCQRVKIPHXTSMX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide?
The IUPAC name of ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide (CID 142011180) is ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide.
What is the SMILES notation for ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide?
The canonical SMILES for ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide is C=C.CCCC(C)C(=O)N/C(N)=N/c1ccc2oc(C)cc2c1.
What is the InChIKey of ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide?
The InChIKey is GCQRVKIPHXTSMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2.C2H4/c1-4-5-10(2)15(20)19-16(17)18-13-6-7-14-12(9-13)8-11(3)21-14;1-2/h6-10H,4-5H2,1-3H3,(H3,17,18,19,20);1-2H2.
What are the key properties of ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide?
ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide has a molecular weight of 315.42 g/mol, XLogP of 4.04, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-methyl-N-[N'-(2-methyl-1-benzofuran-5-yl)carbamimidoyl]pentanamide is sourced from PubChem (CID 142011180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).