C26H30N6O4 — CID 142011579
(3E)-1-cyano-3-[[1-[2-[(2S)-2-hydroxy-4-azaspiro[2.4]heptan-4-yl]-2-oxoethyl]-2-oxoazepan-3-yl]methylidene]-2-(2-methyl-1-benzofuran-5-yl)guanidine (PubChem CID 142011579) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is (3E)-1-cyano-3-[[1-[2-[(2S)-2-hydroxy-4-azaspiro[2.4]heptan-4-yl]-2-oxoethyl]-2-oxoazepan-3-yl]methylidene]-2-(2-methyl-1-benzofuran-5-yl)guanidine.
| Compound Name | (3E)-1-cyano-3-[[1-[2-[(2S)-2-hydroxy-4-azaspiro[2.4]heptan-4-yl]-2-oxoethyl]-2-oxoazepan-3-yl]methylidene]-2-(2-methyl-1-benzofuran-5-yl)guanidine |
|---|---|
| PubChem CID | 142011579 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | (3E)-1-cyano-3-[[1-[2-[(2S)-2-hydroxy-4-azaspiro[2.4]heptan-4-yl]-2-oxoethyl]-2-oxoazepan-3-yl]methylidene]-2-(2-methyl-1-benzofuran-5-yl)guanidine |
| SMILES | Cc1cc2cc(/N=C(/N=C/C3CCCCN(CC(=O)N4CCCC45C[C@@H]5O)C3=O)NC#N)ccc2o1 |
| InChI | InChI=1S/C26H30N6O4/c1-17-11-19-12-20(6-7-21(19)36-17)30-25(29-16-27)28-14-18-5-2-3-9-31(24(18)35)15-23(34)32-10-4-8-26(32)13-22(26)33/h6-7,11-12,14,18,22,33H,2-5,8-10,13,15H2,1H3,(H,29,30)/b28-14+/t18?,22-,26?/m0/s1 |
| InChIKey | KAODAQSRQDBXLQ-GISALOHHSA-N |
| XLogP | 2.62 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|