About N-(4,4-dimethylpentyl)methanesulfonamide;ethane
N-(4,4-dimethylpentyl)methanesulfonamide;ethane (PubChem CID 142011899) has the molecular formula C10H25NO2S
and a molecular weight of 223.38 g/mol. Its IUPAC name is N-(4,4-dimethylpentyl)methanesulfonamide;ethane.
Molecular Properties
| Compound Name | N-(4,4-dimethylpentyl)methanesulfonamide;ethane |
| PubChem CID | 142011899 |
| Molecular Formula | C10H25NO2S |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N-(4,4-dimethylpentyl)methanesulfonamide;ethane |
| SMILES | CC.CC(C)(C)CCCNS(C)(=O)=O |
| InChI | InChI=1S/C8H19NO2S.C2H6/c1-8(2,3)6-5-7-9-12(4,10)11;1-2/h9H,5-7H2,1-4H3;1-2H3 |
| InChIKey | RWRWQSVJKQOCEY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-dimethylpentyl)methanesulfonamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylpentyl)methanesulfonamide;ethane?
The IUPAC name of N-(4,4-dimethylpentyl)methanesulfonamide;ethane (CID 142011899) is N-(4,4-dimethylpentyl)methanesulfonamide;ethane.
What is the SMILES notation for N-(4,4-dimethylpentyl)methanesulfonamide;ethane?
The canonical SMILES for N-(4,4-dimethylpentyl)methanesulfonamide;ethane is CC.CC(C)(C)CCCNS(C)(=O)=O.
What is the InChIKey of N-(4,4-dimethylpentyl)methanesulfonamide;ethane?
The InChIKey is RWRWQSVJKQOCEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO2S.C2H6/c1-8(2,3)6-5-7-9-12(4,10)11;1-2/h9H,5-7H2,1-4H3;1-2H3.
What are the key properties of N-(4,4-dimethylpentyl)methanesulfonamide;ethane?
N-(4,4-dimethylpentyl)methanesulfonamide;ethane has a molecular weight of 223.38 g/mol, XLogP of 2.39, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylpentyl)methanesulfonamide;ethane is sourced from PubChem (CID 142011899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).