About tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane
tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane (PubChem CID 142012065) has the molecular formula C23H39N3O4S
and a molecular weight of 453.65 g/mol. Its IUPAC name is tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane.
Molecular Properties
| Compound Name | tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane |
| PubChem CID | 142012065 |
| Molecular Formula | C23H39N3O4S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane |
| SMILES | CC.CCN(CC(C)(C)CCC#N)S(=O)(=O)c1cccc(N(C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H33N3O4S.C2H6/c1-8-24(16-21(5,6)13-10-14-22)29(26,27)18-12-9-11-17(15-18)23(7)19(25)28-20(2,3)4;1-2/h9,11-12,15H,8,10,13,16H2,1-7H3;1-2H3 |
| InChIKey | LMHDKXDNHZZZCC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane?
The IUPAC name of tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane (CID 142012065) is tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane.
What is the SMILES notation for tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane?
The canonical SMILES for tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane is CC.CCN(CC(C)(C)CCC#N)S(=O)(=O)c1cccc(N(C)C(=O)OC(C)(C)C)c1.
What is the InChIKey of tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane?
The InChIKey is LMHDKXDNHZZZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33N3O4S.C2H6/c1-8-24(16-21(5,6)13-10-14-22)29(26,27)18-12-9-11-17(15-18)23(7)19(25)28-20(2,3)4;1-2/h9,11-12,15H,8,10,13,16H2,1-7H3;1-2H3.
What are the key properties of tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane?
tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane has a molecular weight of 453.65 g/mol, XLogP of 5.42, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[3-[(4-cyano-2,2-dimethylbutyl)-ethylsulfamoyl]phenyl]-N-methylcarbamate;ethane is sourced from PubChem (CID 142012065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).