C32H45N3O9S — CID 142012210
[(4S)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2R,3R)-4-[(6-amino-2,2-dimethylhexyl)-(1,3-benzodioxol-5-ylsulfonyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 142012210) has the molecular formula C32H45N3O9S and a molecular weight of 647.79 g/mol. Its IUPAC name is [(4S)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2R,3R)-4-[(6-amino-2,2-dimethylhexyl)-(1,3-benzodioxol-5-ylsulfonyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(4S)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2R,3R)-4-[(6-amino-2,2-dimethylhexyl)-(1,3-benzodioxol-5-ylsulfonyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142012210 |
| Molecular Formula | C32H45N3O9S |
| Molecular Weight | 647.79 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | [(4S)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2R,3R)-4-[(6-amino-2,2-dimethylhexyl)-(1,3-benzodioxol-5-ylsulfonyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(CCCCN)CN(C[C@@H](O)[C@@H](Cc1ccccc1)NC(=O)O[C@@H]1COC2OCCC21)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C32H45N3O9S/c1-32(2,13-6-7-14-33)20-35(45(38,39)23-10-11-27-28(17-23)43-21-42-27)18-26(36)25(16-22-8-4-3-5-9-22)34-31(37)44-29-19-41-30-24(29)12-15-40-30/h3-5,8-11,17,24-26,29-30,36H,6-7,12-16,18-21,33H2,1-2H3,(H,34,37)/t24?,25-,26-,29-,30?/m1/s1 |
| InChIKey | NLEOTHQDDOEHKU-XJJXXCCPSA-N |
| XLogP | 3.02 |
| TPSA | 158.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|