C29H44O6 — CID 142012392
3-[12,14-dihydroxy-10,13-dimethyl-3-(6-methyloxan-2-yl)oxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one (PubChem CID 142012392) has the molecular formula C29H44O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is 3-[12,14-dihydroxy-10,13-dimethyl-3-(6-methyloxan-2-yl)oxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one.
| Compound Name | 3-[12,14-dihydroxy-10,13-dimethyl-3-(6-methyloxan-2-yl)oxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 142012392 |
| Molecular Formula | C29H44O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | 3-[12,14-dihydroxy-10,13-dimethyl-3-(6-methyloxan-2-yl)oxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
| SMILES | CC1CCCC(OC2CCC3(C)C(CCC4C3CC(O)C3(C)C(C5=CC(=O)OC5)CCC43O)C2)O1 |
| InChI | InChI=1S/C29H44O6/c1-17-5-4-6-26(34-17)35-20-9-11-27(2)19(14-20)7-8-22-23(27)15-24(30)28(3)21(10-12-29(22,28)32)18-13-25(31)33-16-18/h13,17,19-24,26,30,32H,4-12,14-16H2,1-3H3 |
| InChIKey | UDDUZNCCBRJEDN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|