C9H14N2O — CID 142012598
N,2,4-trimethyl-2,3-dihydropyridine-3-carboxamide (PubChem CID 142012598) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is N,2,4-trimethyl-2,3-dihydropyridine-3-carboxamide.
| Compound Name | N,2,4-trimethyl-2,3-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 142012598 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N,2,4-trimethyl-2,3-dihydropyridine-3-carboxamide |
| SMILES | CNC(=O)C1C(C)=CC=NC1C |
| InChI | InChI=1S/C9H14N2O/c1-6-4-5-11-7(2)8(6)9(12)10-3/h4-5,7-8H,1-3H3,(H,10,12) |
| InChIKey | GIYIZPXAEWIWSP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |