C9H14F2N2 — CID 142012950
(N'Z,E)-4-fluoro-N'-(2-fluoropropylidene)-2,2-dimethylbut-3-ene-1,4-diimine (PubChem CID 142012950) has the molecular formula C9H14F2N2 and a molecular weight of 188.22 g/mol. Its IUPAC name is (N'Z,E)-4-fluoro-N'-(2-fluoropropylidene)-2,2-dimethylbut-3-ene-1,4-diimine.
| Compound Name | (N'Z,E)-4-fluoro-N'-(2-fluoropropylidene)-2,2-dimethylbut-3-ene-1,4-diimine |
|---|---|
| PubChem CID | 142012950 |
| Molecular Formula | C9H14F2N2 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | (N'Z,E)-4-fluoro-N'-(2-fluoropropylidene)-2,2-dimethylbut-3-ene-1,4-diimine |
| SMILES | [H]/N=C/C(C)(C)/C=C(F)\N=C/C(C)F |
| InChI | InChI=1S/C9H14F2N2/c1-7(10)5-13-8(11)4-9(2,3)6-12/h4-7,12H,1-3H3/b8-4-,12-6+,13-5- |
| InChIKey | FOHCDNDITYQKOS-MXKVUGLYSA-N |
| XLogP | 2.90 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|