About ethane;4-pyridin-4-ylpyridine
ethane;4-pyridin-4-ylpyridine (PubChem CID 142013036) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is ethane;4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | ethane;4-pyridin-4-ylpyridine |
| PubChem CID | 142013036 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | ethane;4-pyridin-4-ylpyridine |
| SMILES | CC.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.C2H6/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;1-2/h1-8H;1-2H3 |
| InChIKey | VZDDFUOOGJIIAG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-pyridin-4-ylpyridine?
The IUPAC name of ethane;4-pyridin-4-ylpyridine (CID 142013036) is ethane;4-pyridin-4-ylpyridine.
What is the SMILES notation for ethane;4-pyridin-4-ylpyridine?
The canonical SMILES for ethane;4-pyridin-4-ylpyridine is CC.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of ethane;4-pyridin-4-ylpyridine?
The InChIKey is VZDDFUOOGJIIAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C2H6/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;1-2/h1-8H;1-2H3.
What are the key properties of ethane;4-pyridin-4-ylpyridine?
ethane;4-pyridin-4-ylpyridine has a molecular weight of 186.26 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-pyridin-4-ylpyridine is sourced from PubChem (CID 142013036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).