About ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium
ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium (PubChem CID 142013053) has the molecular formula C22H32N+
and a molecular weight of 310.51 g/mol. Its IUPAC name is ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium.
Molecular Properties
| Compound Name | ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium |
| PubChem CID | 142013053 |
| Molecular Formula | C22H32N+ |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium |
| SMILES | C=C/C=C(\CC)c1cc[n+](-c2ccc(C)cc2)cc1.CC.CC |
| InChI | InChI=1S/C18H20N.2C2H6/c1-4-6-16(5-2)17-11-13-19(14-12-17)18-9-7-15(3)8-10-18;2*1-2/h4,6-14H,1,5H2,2-3H3;2*1-2H3/q+1;;/b16-6+;; |
| InChIKey | KFGSMDBIGKDKCN-HEFZRFOPSA-N |
| XLogP | 6.30 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium?
The IUPAC name of ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium (CID 142013053) is ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium.
What is the SMILES notation for ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium?
The canonical SMILES for ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium is C=C/C=C(\CC)c1cc[n+](-c2ccc(C)cc2)cc1.CC.CC.
What is the InChIKey of ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium?
The InChIKey is KFGSMDBIGKDKCN-HEFZRFOPSA-N. The full InChI is InChI=1S/C18H20N.2C2H6/c1-4-6-16(5-2)17-11-13-19(14-12-17)18-9-7-15(3)8-10-18;2*1-2/h4,6-14H,1,5H2,2-3H3;2*1-2H3/q+1;;/b16-6+;;.
What are the key properties of ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium?
ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium has a molecular weight of 310.51 g/mol, XLogP of 6.30, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[(3E)-hexa-3,5-dien-3-yl]-1-(4-methylphenyl)pyridin-1-ium is sourced from PubChem (CID 142013053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).