About 2,3-dimethyl-1H-1,8-naphthyridine-4-thione
2,3-dimethyl-1H-1,8-naphthyridine-4-thione (PubChem CID 142013352) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 2,3-dimethyl-1H-1,8-naphthyridine-4-thione.
Molecular Properties
| Compound Name | 2,3-dimethyl-1H-1,8-naphthyridine-4-thione |
| PubChem CID | 142013352 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2,3-dimethyl-1H-1,8-naphthyridine-4-thione |
| SMILES | Cc1[nH]c2ncccc2c(=S)c1C |
| InChI | InChI=1S/C10H10N2S/c1-6-7(2)12-10-8(9(6)13)4-3-5-11-10/h3-5H,1-2H3,(H,11,12,13) |
| InChIKey | CQFYUBFTIMWMMT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-1H-1,8-naphthyridine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1H-1,8-naphthyridine-4-thione?
The IUPAC name of 2,3-dimethyl-1H-1,8-naphthyridine-4-thione (CID 142013352) is 2,3-dimethyl-1H-1,8-naphthyridine-4-thione.
What is the SMILES notation for 2,3-dimethyl-1H-1,8-naphthyridine-4-thione?
The canonical SMILES for 2,3-dimethyl-1H-1,8-naphthyridine-4-thione is Cc1[nH]c2ncccc2c(=S)c1C.
What is the InChIKey of 2,3-dimethyl-1H-1,8-naphthyridine-4-thione?
The InChIKey is CQFYUBFTIMWMMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S/c1-6-7(2)12-10-8(9(6)13)4-3-5-11-10/h3-5H,1-2H3,(H,11,12,13).
What are the key properties of 2,3-dimethyl-1H-1,8-naphthyridine-4-thione?
2,3-dimethyl-1H-1,8-naphthyridine-4-thione has a molecular weight of 190.27 g/mol, XLogP of 2.91, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1H-1,8-naphthyridine-4-thione is sourced from PubChem (CID 142013352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).