About (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane
(Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane (PubChem CID 142013519) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane.
Molecular Properties
| Compound Name | (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane |
| PubChem CID | 142013519 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane |
| SMILES | C/C=C\C(=C/C)CC(CN)CO.CC.CC |
| InChI | InChI=1S/C10H19NO.2C2H6/c1-3-5-9(4-2)6-10(7-11)8-12;2*1-2/h3-5,10,12H,6-8,11H2,1-2H3;2*1-2H3/b5-3-,9-4+;; |
| InChIKey | OMPPTXQHCRKGLQ-ULOKQNOHSA-N |
| XLogP | 3.52 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane?
The IUPAC name of (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane (CID 142013519) is (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane.
What is the SMILES notation for (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane?
The canonical SMILES for (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane is C/C=C\C(=C/C)CC(CN)CO.CC.CC.
What is the InChIKey of (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane?
The InChIKey is OMPPTXQHCRKGLQ-ULOKQNOHSA-N. The full InChI is InChI=1S/C10H19NO.2C2H6/c1-3-5-9(4-2)6-10(7-11)8-12;2*1-2/h3-5,10,12H,6-8,11H2,1-2H3;2*1-2H3/b5-3-,9-4+;;.
What are the key properties of (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane?
(Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane has a molecular weight of 229.41 g/mol, XLogP of 3.52, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,4Z)-2-(aminomethyl)-4-ethylidenehept-5-en-1-ol;ethane is sourced from PubChem (CID 142013519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).