About 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane
4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane (PubChem CID 142013543) has the molecular formula C23H35NO2S
and a molecular weight of 389.61 g/mol. Its IUPAC name is 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane.
Molecular Properties
| Compound Name | 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane |
| PubChem CID | 142013543 |
| Molecular Formula | C23H35NO2S |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane |
| SMILES | C=C(/C=C(\SC)c1ccc(O)cc1)c1ccc(ON)cc1.CC.CC.CC |
| InChI | InChI=1S/C17H17NO2S.3C2H6/c1-12(13-5-9-16(20-18)10-6-13)11-17(21-2)14-3-7-15(19)8-4-14;3*1-2/h3-11,19H,1,18H2,2H3;3*1-2H3/b17-11-;;; |
| InChIKey | JKFJBRSUEHVLCH-UMCYPVTFSA-N |
| XLogP | 7.14 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane?
The IUPAC name of 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane (CID 142013543) is 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane.
What is the SMILES notation for 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane?
The canonical SMILES for 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane is C=C(/C=C(\SC)c1ccc(O)cc1)c1ccc(ON)cc1.CC.CC.CC.
What is the InChIKey of 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane?
The InChIKey is JKFJBRSUEHVLCH-UMCYPVTFSA-N. The full InChI is InChI=1S/C17H17NO2S.3C2H6/c1-12(13-5-9-16(20-18)10-6-13)11-17(21-2)14-3-7-15(19)8-4-14;3*1-2/h3-11,19H,1,18H2,2H3;3*1-2H3/b17-11-;;;.
What are the key properties of 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane?
4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane has a molecular weight of 389.61 g/mol, XLogP of 7.14, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1Z)-3-(4-aminooxyphenyl)-1-methylsulfanylbuta-1,3-dienyl]phenol;ethane is sourced from PubChem (CID 142013543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).