C29H32ClF3N2OS2 — CID 142014136
4-[2-[1-(N-(4-chlorophenyl)sulfanyl-2,5-difluoroanilino)ethyl]phenyl]-1-thiomorpholin-4-ylbutan-1-one;fluoromethane (PubChem CID 142014136) has the molecular formula C29H32ClF3N2OS2 and a molecular weight of 581.17 g/mol. Its IUPAC name is 4-[2-[1-(N-(4-chlorophenyl)sulfanyl-2,5-difluoroanilino)ethyl]phenyl]-1-thiomorpholin-4-ylbutan-1-one;fluoromethane.
| Compound Name | 4-[2-[1-(N-(4-chlorophenyl)sulfanyl-2,5-difluoroanilino)ethyl]phenyl]-1-thiomorpholin-4-ylbutan-1-one;fluoromethane |
|---|---|
| PubChem CID | 142014136 |
| Molecular Formula | C29H32ClF3N2OS2 |
| Molecular Weight | 581.17 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 4-[2-[1-(N-(4-chlorophenyl)sulfanyl-2,5-difluoroanilino)ethyl]phenyl]-1-thiomorpholin-4-ylbutan-1-one;fluoromethane |
| SMILES | CC(c1ccccc1CCCC(=O)N1CCSCC1)N(Sc1ccc(Cl)cc1)c1cc(F)ccc1F.CF |
| InChI | InChI=1S/C28H29ClF2N2OS2.CH3F/c1-20(25-7-3-2-5-21(25)6-4-8-28(34)32-15-17-35-18-16-32)33(27-19-23(30)11-14-26(27)31)36-24-12-9-22(29)10-13-24;1-2/h2-3,5,7,9-14,19-20H,4,6,8,15-18H2,1H3;1H3 |
| InChIKey | OLCLYFBLSDGORI-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.17 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|