C17H27NO2 — CID 142014210
[3-methyl-7-(3-piperidin-1-ylpropoxy)cyclohepta-1,4,6-trien-1-yl]methanol (PubChem CID 142014210) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is [3-methyl-7-(3-piperidin-1-ylpropoxy)cyclohepta-1,4,6-trien-1-yl]methanol.
| Compound Name | [3-methyl-7-(3-piperidin-1-ylpropoxy)cyclohepta-1,4,6-trien-1-yl]methanol |
|---|---|
| PubChem CID | 142014210 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | [3-methyl-7-(3-piperidin-1-ylpropoxy)cyclohepta-1,4,6-trien-1-yl]methanol |
| SMILES | CC1C=CC=C(OCCCN2CCCCC2)C(CO)=C1 |
| InChI | InChI=1S/C17H27NO2/c1-15-7-5-8-17(16(13-15)14-19)20-12-6-11-18-9-3-2-4-10-18/h5,7-8,13,15,19H,2-4,6,9-12,14H2,1H3 |
| InChIKey | HPCVDBCPUZYKNL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|