C20H35NO3 — CID 142014262
ethane;methyl 7-[3-[ethyl(propyl)amino]propoxy]-3-methylcyclohepta-1,4,6-triene-1-carboxylate (PubChem CID 142014262) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is ethane;methyl 7-[3-[ethyl(propyl)amino]propoxy]-3-methylcyclohepta-1,4,6-triene-1-carboxylate.
| Compound Name | ethane;methyl 7-[3-[ethyl(propyl)amino]propoxy]-3-methylcyclohepta-1,4,6-triene-1-carboxylate |
|---|---|
| PubChem CID | 142014262 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | ethane;methyl 7-[3-[ethyl(propyl)amino]propoxy]-3-methylcyclohepta-1,4,6-triene-1-carboxylate |
| SMILES | CC.CCCN(CC)CCCOC1=CC=CC(C)C=C1C(=O)OC |
| InChI | InChI=1S/C18H29NO3.C2H6/c1-5-11-19(6-2)12-8-13-22-17-10-7-9-15(3)14-16(17)18(20)21-4;1-2/h7,9-10,14-15H,5-6,8,11-13H2,1-4H3;1-2H3 |
| InChIKey | BNMOZLTXXXNPHS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|