C20H25NO2 — CID 14201440
2-(4-ethenyl-1,8-diethyl-2,3,4,9-tetrahydrocarbazol-1-yl)acetic acid (PubChem CID 14201440) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-(4-ethenyl-1,8-diethyl-2,3,4,9-tetrahydrocarbazol-1-yl)acetic acid.
| Compound Name | 2-(4-ethenyl-1,8-diethyl-2,3,4,9-tetrahydrocarbazol-1-yl)acetic acid |
|---|---|
| PubChem CID | 14201440 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-(4-ethenyl-1,8-diethyl-2,3,4,9-tetrahydrocarbazol-1-yl)acetic acid |
| SMILES | C=CC1CCC(CC)(CC(=O)O)c2[nH]c3c(CC)cccc3c21 |
| InChI | InChI=1S/C20H25NO2/c1-4-13-10-11-20(6-3,12-16(22)23)19-17(13)15-9-7-8-14(5-2)18(15)21-19/h4,7-9,13,21H,1,5-6,10-12H2,2-3H3,(H,22,23) |
| InChIKey | ATXOZATVZXNMDI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|