About ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one
ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one (PubChem CID 142014543) has the molecular formula C14H18O3
and a molecular weight of 234.29 g/mol. Its IUPAC name is ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one.
Molecular Properties
| Compound Name | ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one |
| PubChem CID | 142014543 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one |
| SMILES | CC.Cc1cc2c(oc1=O)C=CC(C)(O)C=C2 |
| InChI | InChI=1S/C12H12O3.C2H6/c1-8-7-9-3-5-12(2,14)6-4-10(9)15-11(8)13;1-2/h3-7,14H,1-2H3;1-2H3 |
| InChIKey | ZLCYMNZJXXRVJW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one?
The IUPAC name of ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one (CID 142014543) is ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one.
What is the SMILES notation for ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one?
The canonical SMILES for ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one is CC.Cc1cc2c(oc1=O)C=CC(C)(O)C=C2.
What is the InChIKey of ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one?
The InChIKey is ZLCYMNZJXXRVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3.C2H6/c1-8-7-9-3-5-12(2,14)6-4-10(9)15-11(8)13;1-2/h3-7,14H,1-2H3;1-2H3.
What are the key properties of ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one?
ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one has a molecular weight of 234.29 g/mol, XLogP of 2.77, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-hydroxy-3,7-dimethylcyclohepta[b]pyran-2-one is sourced from PubChem (CID 142014543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).