C15H28 — CID 142014547
6,6-dimethyl-1,2,3,4,5,7,8,9-octahydrobenzo[7]annulene;ethane (PubChem CID 142014547) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 6,6-dimethyl-1,2,3,4,5,7,8,9-octahydrobenzo[7]annulene;ethane.
| Compound Name | 6,6-dimethyl-1,2,3,4,5,7,8,9-octahydrobenzo[7]annulene;ethane |
|---|---|
| PubChem CID | 142014547 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 6,6-dimethyl-1,2,3,4,5,7,8,9-octahydrobenzo[7]annulene;ethane |
| SMILES | CC.CC1(C)CCCC2=C(CCCC2)C1 |
| InChI | InChI=1S/C13H22.C2H6/c1-13(2)9-5-8-11-6-3-4-7-12(11)10-13;1-2/h3-10H2,1-2H3;1-2H3 |
| InChIKey | GFYMIHUAIGPZGD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|