About N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine
N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine (PubChem CID 14201469) has the molecular formula C22H31N3OS
and a molecular weight of 385.58 g/mol. Its IUPAC name is N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine.
Molecular Properties
| Compound Name | N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine |
| PubChem CID | 14201469 |
| Molecular Formula | C22H31N3OS |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCCOc1ccc(-c2cn3ccsc3n2)cc1 |
| InChI | InChI=1S/C22H31N3OS/c1-3-5-12-24(13-6-4-2)14-7-16-26-20-10-8-19(9-11-20)21-18-25-15-17-27-22(25)23-21/h8-11,15,17-18H,3-7,12-14,16H2,1-2H3 |
| InChIKey | GGGVHDALVVYRSM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine?
The IUPAC name of N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine (CID 14201469) is N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine.
What is the SMILES notation for N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine?
The canonical SMILES for N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine is CCCCN(CCCC)CCCOc1ccc(-c2cn3ccsc3n2)cc1.
What is the InChIKey of N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine?
The InChIKey is GGGVHDALVVYRSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N3OS/c1-3-5-12-24(13-6-4-2)14-7-16-26-20-10-8-19(9-11-20)21-18-25-15-17-27-22(25)23-21/h8-11,15,17-18H,3-7,12-14,16H2,1-2H3.
What are the key properties of N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine?
N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine has a molecular weight of 385.58 g/mol, XLogP of 5.73, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-[3-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenoxy)propyl]butan-1-amine is sourced from PubChem (CID 14201469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).