C10H15NO4S — CID 142014869
2-amino-4-hydroxy-5-(2-methylfuran-3-yl)sulfanylpentanoic acid (PubChem CID 142014869) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-amino-4-hydroxy-5-(2-methylfuran-3-yl)sulfanylpentanoic acid.
| Compound Name | 2-amino-4-hydroxy-5-(2-methylfuran-3-yl)sulfanylpentanoic acid |
|---|---|
| PubChem CID | 142014869 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-amino-4-hydroxy-5-(2-methylfuran-3-yl)sulfanylpentanoic acid |
| SMILES | Cc1occc1SCC(O)CC(N)C(=O)O |
| InChI | InChI=1S/C10H15NO4S/c1-6-9(2-3-15-6)16-5-7(12)4-8(11)10(13)14/h2-3,7-8,12H,4-5,11H2,1H3,(H,13,14) |
| InChIKey | PUGABMJNMFZTHV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |