C31H44N6OS — CID 142015365
N,N'-diamino-4-[3-[1-[[(3R)-1-benzylpyrrolidin-3-yl]methyl]-4-hydroxypiperidin-4-yl]propyl]benzenecarboximidamide;thiophene (PubChem CID 142015365) has the molecular formula C31H44N6OS and a molecular weight of 548.80 g/mol. Its IUPAC name is N,N'-diamino-4-[3-[1-[[(3R)-1-benzylpyrrolidin-3-yl]methyl]-4-hydroxypiperidin-4-yl]propyl]benzenecarboximidamide;thiophene.
| Compound Name | N,N'-diamino-4-[3-[1-[[(3R)-1-benzylpyrrolidin-3-yl]methyl]-4-hydroxypiperidin-4-yl]propyl]benzenecarboximidamide;thiophene |
|---|---|
| PubChem CID | 142015365 |
| Molecular Formula | C31H44N6OS |
| Molecular Weight | 548.80 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | N,N'-diamino-4-[3-[1-[[(3R)-1-benzylpyrrolidin-3-yl]methyl]-4-hydroxypiperidin-4-yl]propyl]benzenecarboximidamide;thiophene |
| SMILES | N/N=C(\NN)c1ccc(CCCC2(O)CCN(C[C@H]3CCN(Cc4ccccc4)C3)CC2)cc1.c1ccsc1 |
| InChI | InChI=1S/C27H40N6O.C4H4S/c28-30-26(31-29)25-10-8-22(9-11-25)7-4-13-27(34)14-17-32(18-15-27)20-24-12-16-33(21-24)19-23-5-2-1-3-6-23;1-2-4-5-3-1/h1-3,5-6,8-11,24,34H,4,7,12-21,28-29H2,(H,30,31);1-4H/t24-;/m1./s1 |
| InChIKey | BIZTVYNCGYNJKR-GJFSDDNBSA-N |
| XLogP | 4.19 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|